C24H25F3N4O3 — CID 52936020
N-[5-hydroxy-1-[(3,4,5-trifluorophenyl)methyl]piperidin-3-yl]-3-methoxy-4-(4-methylimidazol-1-yl)benzamide (PubChem CID 52936020) has the molecular formula C24H25F3N4O3 and a molecular weight of 474.48 g/mol. Its IUPAC name is N-[5-hydroxy-1-[(3,4,5-trifluorophenyl)methyl]piperidin-3-yl]-3-methoxy-4-(4-methylimidazol-1-yl)benzamide.
| Compound Name | N-[5-hydroxy-1-[(3,4,5-trifluorophenyl)methyl]piperidin-3-yl]-3-methoxy-4-(4-methylimidazol-1-yl)benzamide |
|---|---|
| PubChem CID | 52936020 |
| Molecular Formula | C24H25F3N4O3 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | N-[5-hydroxy-1-[(3,4,5-trifluorophenyl)methyl]piperidin-3-yl]-3-methoxy-4-(4-methylimidazol-1-yl)benzamide |
| SMILES | COc1cc(C(=O)NC2CC(O)CN(Cc3cc(F)c(F)c(F)c3)C2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C24H25F3N4O3/c1-14-9-31(13-28-14)21-4-3-16(7-22(21)34-2)24(33)29-17-8-18(32)12-30(11-17)10-15-5-19(25)23(27)20(26)6-15/h3-7,9,13,17-18,32H,8,10-12H2,1-2H3,(H,29,33) |
| InChIKey | WHVSVBAYACBHPK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|