About 2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]guanidine;bis(nitric acid)
2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]guanidine;bis(nitric acid) (PubChem CID 86632605) has the molecular formula C12H17N7O7
and a molecular weight of 371.31 g/mol. Its IUPAC name is 2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]guanidine;bis(nitric acid).
Molecular Properties
| Compound Name | 2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]guanidine;bis(nitric acid) |
| PubChem CID | 86632605 |
| Molecular Formula | C12H17N7O7 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]guanidine;bis(nitric acid) |
| SMILES | COc1cc(N=C(N)N)ccc1-n1cnc(C)c1.O=[N+]([O-])O.O=[N+]([O-])O |
| InChI | InChI=1S/C12H15N5O.2HNO3/c1-8-6-17(7-15-8)10-4-3-9(16-12(13)14)5-11(10)18-2;2*2-1(3)4/h3-7H,1-2H3,(H4,13,14,16);2*(H,2,3,4) |
| InChIKey | QZLHIBRODJIZHU-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 218.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]guanidine;bis(nitric acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]guanidine;bis(nitric acid)?
The IUPAC name of 2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]guanidine;bis(nitric acid) (CID 86632605) is 2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]guanidine;bis(nitric acid).
What is the SMILES notation for 2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]guanidine;bis(nitric acid)?
The canonical SMILES for 2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]guanidine;bis(nitric acid) is COc1cc(N=C(N)N)ccc1-n1cnc(C)c1.O=[N+]([O-])O.O=[N+]([O-])O.
What is the InChIKey of 2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]guanidine;bis(nitric acid)?
The InChIKey is QZLHIBRODJIZHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N5O.2HNO3/c1-8-6-17(7-15-8)10-4-3-9(16-12(13)14)5-11(10)18-2;2*2-1(3)4/h3-7H,1-2H3,(H4,13,14,16);2*(H,2,3,4).
What are the key properties of 2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]guanidine;bis(nitric acid)?
2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]guanidine;bis(nitric acid) has a molecular weight of 371.31 g/mol, XLogP of 0.40, 3 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]guanidine;bis(nitric acid) is sourced from PubChem (CID 86632605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).