C27H33ClN6O2 — CID 91255488
4-(4-chlorophenyl)-N'-[N'-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]carbamimidoyl]-N,N,2,4-tetramethyl-3-oxopentanimidamide (PubChem CID 91255488) has the molecular formula C27H33ClN6O2 and a molecular weight of 509.05 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[N'-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]carbamimidoyl]-N,N,2,4-tetramethyl-3-oxopentanimidamide.
| Compound Name | 4-(4-chlorophenyl)-N'-[N'-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]carbamimidoyl]-N,N,2,4-tetramethyl-3-oxopentanimidamide |
|---|---|
| PubChem CID | 91255488 |
| Molecular Formula | C27H33ClN6O2 |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[N'-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]carbamimidoyl]-N,N,2,4-tetramethyl-3-oxopentanimidamide |
| SMILES | COc1cc(/N=C(\N)N=C(C(C)C(=O)C(C)(C)c2ccc(Cl)cc2)N(C)C)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C27H33ClN6O2/c1-17-15-34(16-30-17)22-13-12-21(14-23(22)36-7)31-26(29)32-25(33(5)6)18(2)24(35)27(3,4)19-8-10-20(28)11-9-19/h8-16,18H,1-7H3,(H2,29,31) |
| InChIKey | NXRKRRIUTYURNY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 98.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|