C16H16O9 — CID 70258513
5-(3,4-diacetyloxyphenyl)-2-hydroxy-2-(hydroxymethyl)-3-oxopent-4-enoic acid (PubChem CID 70258513) has the molecular formula C16H16O9 and a molecular weight of 352.30 g/mol. Its IUPAC name is 5-(3,4-diacetyloxyphenyl)-2-hydroxy-2-(hydroxymethyl)-3-oxopent-4-enoic acid.
| Compound Name | 5-(3,4-diacetyloxyphenyl)-2-hydroxy-2-(hydroxymethyl)-3-oxopent-4-enoic acid |
|---|---|
| PubChem CID | 70258513 |
| Molecular Formula | C16H16O9 |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 5-(3,4-diacetyloxyphenyl)-2-hydroxy-2-(hydroxymethyl)-3-oxopent-4-enoic acid |
| SMILES | CC(=O)Oc1ccc(C=CC(=O)C(O)(CO)C(=O)O)cc1OC(C)=O |
| InChI | InChI=1S/C16H16O9/c1-9(18)24-12-5-3-11(7-13(12)25-10(2)19)4-6-14(20)16(23,8-17)15(21)22/h3-7,17,23H,8H2,1-2H3,(H,21,22) |
| InChIKey | JIEIPQCQXGKHKH-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|