C16H23ClO — CID 70259668
4-[3-(2-chloro-4-methylphenyl)propyl]cyclohexan-1-ol (PubChem CID 70259668) has the molecular formula C16H23ClO and a molecular weight of 266.81 g/mol. Its IUPAC name is 4-[3-(2-chloro-4-methylphenyl)propyl]cyclohexan-1-ol.
| Compound Name | 4-[3-(2-chloro-4-methylphenyl)propyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 70259668 |
| Molecular Formula | C16H23ClO |
| Molecular Weight | 266.81 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 4-[3-(2-chloro-4-methylphenyl)propyl]cyclohexan-1-ol |
| SMILES | Cc1ccc(CCCC2CCC(O)CC2)c(Cl)c1 |
| InChI | InChI=1S/C16H23ClO/c1-12-5-8-14(16(17)11-12)4-2-3-13-6-9-15(18)10-7-13/h5,8,11,13,15,18H,2-4,6-7,9-10H2,1H3 |
| InChIKey | GHISBECLIQZGHU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.81 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |