C12H17NO2 — CID 70260790
N-ethyl-7-methoxy-3,4-dihydro-2H-chromen-2-amine (PubChem CID 70260790) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is N-ethyl-7-methoxy-3,4-dihydro-2H-chromen-2-amine.
| Compound Name | N-ethyl-7-methoxy-3,4-dihydro-2H-chromen-2-amine |
|---|---|
| PubChem CID | 70260790 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N-ethyl-7-methoxy-3,4-dihydro-2H-chromen-2-amine |
| SMILES | CCNC1CCc2ccc(OC)cc2O1 |
| InChI | InChI=1S/C12H17NO2/c1-3-13-12-7-5-9-4-6-10(14-2)8-11(9)15-12/h4,6,8,12-13H,3,5,7H2,1-2H3 |
| InChIKey | UFCFAOXZJUTCPL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |