About 4-(7-methoxy-3,4-dihydro-2H-chromen-2-yl)benzene-1,2-diol
4-(7-methoxy-3,4-dihydro-2H-chromen-2-yl)benzene-1,2-diol (PubChem CID 14157885) has the molecular formula C16H16O4
and a molecular weight of 272.30 g/mol. Its IUPAC name is 4-(7-methoxy-3,4-dihydro-2H-chromen-2-yl)benzene-1,2-diol.
Molecular Properties
| Compound Name | 4-(7-methoxy-3,4-dihydro-2H-chromen-2-yl)benzene-1,2-diol |
| PubChem CID | 14157885 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 4-(7-methoxy-3,4-dihydro-2H-chromen-2-yl)benzene-1,2-diol |
| SMILES | COc1ccc2c(c1)OC(c1ccc(O)c(O)c1)CC2 |
| InChI | InChI=1S/C16H16O4/c1-19-12-5-2-10-4-7-15(20-16(10)9-12)11-3-6-13(17)14(18)8-11/h2-3,5-6,8-9,15,17-18H,4,7H2,1H3 |
| InChIKey | RFPAIRSYRWTZLD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-(7-methoxy-3,4-dihydro-2H-chromen-2-yl)benzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-methoxy-3,4-dihydro-2H-chromen-2-yl)benzene-1,2-diol?
The IUPAC name of 4-(7-methoxy-3,4-dihydro-2H-chromen-2-yl)benzene-1,2-diol (CID 14157885) is 4-(7-methoxy-3,4-dihydro-2H-chromen-2-yl)benzene-1,2-diol.
What is the SMILES notation for 4-(7-methoxy-3,4-dihydro-2H-chromen-2-yl)benzene-1,2-diol?
The canonical SMILES for 4-(7-methoxy-3,4-dihydro-2H-chromen-2-yl)benzene-1,2-diol is COc1ccc2c(c1)OC(c1ccc(O)c(O)c1)CC2.
What is the InChIKey of 4-(7-methoxy-3,4-dihydro-2H-chromen-2-yl)benzene-1,2-diol?
The InChIKey is RFPAIRSYRWTZLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O4/c1-19-12-5-2-10-4-7-15(20-16(10)9-12)11-3-6-13(17)14(18)8-11/h2-3,5-6,8-9,15,17-18H,4,7H2,1H3.
What are the key properties of 4-(7-methoxy-3,4-dihydro-2H-chromen-2-yl)benzene-1,2-diol?
4-(7-methoxy-3,4-dihydro-2H-chromen-2-yl)benzene-1,2-diol has a molecular weight of 272.30 g/mol, XLogP of 3.17, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-methoxy-3,4-dihydro-2H-chromen-2-yl)benzene-1,2-diol is sourced from PubChem (CID 14157885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).