C21H22O5 — CID 145016023
methyl 3-[2-(3-formyl-4-hydroxyphenyl)-3,4-dihydro-2H-chromen-7-yl]-2-methylpropanoate (PubChem CID 145016023) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is methyl 3-[2-(3-formyl-4-hydroxyphenyl)-3,4-dihydro-2H-chromen-7-yl]-2-methylpropanoate.
| Compound Name | methyl 3-[2-(3-formyl-4-hydroxyphenyl)-3,4-dihydro-2H-chromen-7-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 145016023 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | methyl 3-[2-(3-formyl-4-hydroxyphenyl)-3,4-dihydro-2H-chromen-7-yl]-2-methylpropanoate |
| SMILES | COC(=O)C(C)Cc1ccc2c(c1)OC(c1ccc(O)c(C=O)c1)CC2 |
| InChI | InChI=1S/C21H22O5/c1-13(21(24)25-2)9-14-3-4-15-6-8-19(26-20(15)10-14)16-5-7-18(23)17(11-16)12-22/h3-5,7,10-13,19,23H,6,8-9H2,1-2H3 |
| InChIKey | MHGQHJLZBZCQBR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|