About [2-(1-aminoethyl)furan-3-yl]tin(3+);ethanethiolate
[2-(1-aminoethyl)furan-3-yl]tin(3+);ethanethiolate (PubChem CID 70261674) has the molecular formula C12H23NOS3Sn
and a molecular weight of 412.23 g/mol. Its IUPAC name is [2-(1-aminoethyl)furan-3-yl]tin(3+);ethanethiolate.
Molecular Properties
| Compound Name | [2-(1-aminoethyl)furan-3-yl]tin(3+);ethanethiolate |
| PubChem CID | 70261674 |
| Molecular Formula | C12H23NOS3Sn |
| Molecular Weight | 412.23 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | [2-(1-aminoethyl)furan-3-yl]tin(3+);ethanethiolate |
| SMILES | CC(N)c1occc1[Sn+3].CC[S-].CC[S-].CC[S-] |
| InChI | InChI=1S/C6H8NO.3C2H6S.Sn/c1-5(7)6-3-2-4-8-6;3*1-2-3;/h2,4-5H,7H2,1H3;3*3H,2H2,1H3;/q;;;;+3/p-3 |
| InChIKey | DSLCXPBLANRQCT-UHFFFAOYSA-K |
| XLogP | 1.75 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(1-aminoethyl)furan-3-yl]tin(3+);ethanethiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1-aminoethyl)furan-3-yl]tin(3+);ethanethiolate?
The IUPAC name of [2-(1-aminoethyl)furan-3-yl]tin(3+);ethanethiolate (CID 70261674) is [2-(1-aminoethyl)furan-3-yl]tin(3+);ethanethiolate.
What is the SMILES notation for [2-(1-aminoethyl)furan-3-yl]tin(3+);ethanethiolate?
The canonical SMILES for [2-(1-aminoethyl)furan-3-yl]tin(3+);ethanethiolate is CC(N)c1occc1[Sn+3].CC[S-].CC[S-].CC[S-].
What is the InChIKey of [2-(1-aminoethyl)furan-3-yl]tin(3+);ethanethiolate?
The InChIKey is DSLCXPBLANRQCT-UHFFFAOYSA-K. The full InChI is InChI=1S/C6H8NO.3C2H6S.Sn/c1-5(7)6-3-2-4-8-6;3*1-2-3;/h2,4-5H,7H2,1H3;3*3H,2H2,1H3;/q;;;;+3/p-3.
What are the key properties of [2-(1-aminoethyl)furan-3-yl]tin(3+);ethanethiolate?
[2-(1-aminoethyl)furan-3-yl]tin(3+);ethanethiolate has a molecular weight of 412.23 g/mol, XLogP of 1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1-aminoethyl)furan-3-yl]tin(3+);ethanethiolate is sourced from PubChem (CID 70261674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).