C20H19BrN2O5S — CID 70268180
ethyl 1-(2-bromo-3-methoxyphenyl)-5-(4-methylsulfonylphenyl)pyrazole-3-carboxylate (PubChem CID 70268180) has the molecular formula C20H19BrN2O5S and a molecular weight of 479.35 g/mol. Its IUPAC name is ethyl 1-(2-bromo-3-methoxyphenyl)-5-(4-methylsulfonylphenyl)pyrazole-3-carboxylate.
| Compound Name | ethyl 1-(2-bromo-3-methoxyphenyl)-5-(4-methylsulfonylphenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 70268180 |
| Molecular Formula | C20H19BrN2O5S |
| Molecular Weight | 479.35 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | ethyl 1-(2-bromo-3-methoxyphenyl)-5-(4-methylsulfonylphenyl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(S(C)(=O)=O)cc2)n(-c2cccc(OC)c2Br)n1 |
| InChI | InChI=1S/C20H19BrN2O5S/c1-4-28-20(24)15-12-17(13-8-10-14(11-9-13)29(3,25)26)23(22-15)16-6-5-7-18(27-2)19(16)21/h5-12H,4H2,1-3H3 |
| InChIKey | YACRMLJXDJTVEB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |