C31H45N3O3 — CID 70270286
1-[2-[(1R,3aS,3bS,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-1-yl]propyl]-3-(2-ethoxyphenyl)urea (PubChem CID 70270286) has the molecular formula C31H45N3O3 and a molecular weight of 507.72 g/mol. Its IUPAC name is 1-[2-[(1R,3aS,3bS,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-1-yl]propyl]-3-(2-ethoxyphenyl)urea.
| Compound Name | 1-[2-[(1R,3aS,3bS,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-1-yl]propyl]-3-(2-ethoxyphenyl)urea |
|---|---|
| PubChem CID | 70270286 |
| Molecular Formula | C31H45N3O3 |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.35 |
| IUPAC Name | 1-[2-[(1R,3aS,3bS,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-1-yl]propyl]-3-(2-ethoxyphenyl)urea |
| SMILES | CCOc1ccccc1NC(=O)NCC(C)[C@H]1CC[C@H]2[C@@H]3CCC4N(C)C(=O)C=C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H45N3O3/c1-6-37-26-10-8-7-9-25(26)33-29(36)32-19-20(2)22-12-13-23-21-11-14-27-31(4,18-16-28(35)34(27)5)24(21)15-17-30(22,23)3/h7-10,16,18,20-24,27H,6,11-15,17,19H2,1-5H3,(H2,32,33,36)/t20?,21-,22+,23-,24-,27?,30+,31+/m0/s1 |
| InChIKey | BYVNZZBKTBUJIW-DOLVUGIBSA-N |
| XLogP | 6.10 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |