C21H27IN2O4 — CID 70271155
ethyl 2-[4-[2-[[(1S,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]-2-iodoanilino]acetate (PubChem CID 70271155) has the molecular formula C21H27IN2O4 and a molecular weight of 498.36 g/mol. Its IUPAC name is ethyl 2-[4-[2-[[(1S,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]-2-iodoanilino]acetate.
| Compound Name | ethyl 2-[4-[2-[[(1S,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]-2-iodoanilino]acetate |
|---|---|
| PubChem CID | 70271155 |
| Molecular Formula | C21H27IN2O4 |
| Molecular Weight | 498.36 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | ethyl 2-[4-[2-[[(1S,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]-2-iodoanilino]acetate |
| SMILES | CCOC(=O)CNc1ccc(CCN[C@@H](C)[C@@H](O)c2ccc(O)cc2)cc1I |
| InChI | InChI=1S/C21H27IN2O4/c1-3-28-20(26)13-24-19-9-4-15(12-18(19)22)10-11-23-14(2)21(27)16-5-7-17(25)8-6-16/h4-9,12,14,21,23-25,27H,3,10-11,13H2,1-2H3/t14-,21+/m0/s1 |
| InChIKey | QQJKETCXIHXLGZ-LHSJRXKWSA-N |
| XLogP | 3.23 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|