About dimethyl(15-phenylpentadecyl)azanium;chloride;dihydrate
dimethyl(15-phenylpentadecyl)azanium;chloride;dihydrate (PubChem CID 70271665) has the molecular formula C23H46ClNO2
and a molecular weight of 404.08 g/mol. Its IUPAC name is dimethyl(15-phenylpentadecyl)azanium;chloride;dihydrate.
Molecular Properties
| Compound Name | dimethyl(15-phenylpentadecyl)azanium;chloride;dihydrate |
| PubChem CID | 70271665 |
| Molecular Formula | C23H46ClNO2 |
| Molecular Weight | 404.08 g/mol |
| Exact Mass | 403.32 |
| IUPAC Name | dimethyl(15-phenylpentadecyl)azanium;chloride;dihydrate |
| SMILES | C[NH+](C)CCCCCCCCCCCCCCCc1ccccc1.O.O.[Cl-] |
| InChI | InChI=1S/C23H41N.ClH.2H2O/c1-24(2)22-18-13-11-9-7-5-3-4-6-8-10-12-15-19-23-20-16-14-17-21-23;;;/h14,16-17,20-21H,3-13,15,18-19,22H2,1-2H3;1H;2*1H2 |
| InChIKey | PYTZGMHXJGFXGZ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 67.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.08 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(15-phenylpentadecyl)azanium;chloride;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(15-phenylpentadecyl)azanium;chloride;dihydrate?
The IUPAC name of dimethyl(15-phenylpentadecyl)azanium;chloride;dihydrate (CID 70271665) is dimethyl(15-phenylpentadecyl)azanium;chloride;dihydrate.
What is the SMILES notation for dimethyl(15-phenylpentadecyl)azanium;chloride;dihydrate?
The canonical SMILES for dimethyl(15-phenylpentadecyl)azanium;chloride;dihydrate is C[NH+](C)CCCCCCCCCCCCCCCc1ccccc1.O.O.[Cl-].
What is the InChIKey of dimethyl(15-phenylpentadecyl)azanium;chloride;dihydrate?
The InChIKey is PYTZGMHXJGFXGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H41N.ClH.2H2O/c1-24(2)22-18-13-11-9-7-5-3-4-6-8-10-12-15-19-23-20-16-14-17-21-23;;;/h14,16-17,20-21H,3-13,15,18-19,22H2,1-2H3;1H;2*1H2.
What are the key properties of dimethyl(15-phenylpentadecyl)azanium;chloride;dihydrate?
dimethyl(15-phenylpentadecyl)azanium;chloride;dihydrate has a molecular weight of 404.08 g/mol, XLogP of 0.80, 16 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(15-phenylpentadecyl)azanium;chloride;dihydrate is sourced from PubChem (CID 70271665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).