C22H22N2O6 — CID 7027425
[(2R)-1-(2-methoxyanilino)-1-oxobutan-2-yl] (2S)-2-(2,3-dioxoindol-1-yl)propanoate (PubChem CID 7027425) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is [(2R)-1-(2-methoxyanilino)-1-oxobutan-2-yl] (2S)-2-(2,3-dioxoindol-1-yl)propanoate.
| Compound Name | [(2R)-1-(2-methoxyanilino)-1-oxobutan-2-yl] (2S)-2-(2,3-dioxoindol-1-yl)propanoate |
|---|---|
| PubChem CID | 7027425 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | [(2R)-1-(2-methoxyanilino)-1-oxobutan-2-yl] (2S)-2-(2,3-dioxoindol-1-yl)propanoate |
| SMILES | CC[C@@H](OC(=O)[C@H](C)N1C(=O)C(=O)c2ccccc21)C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C22H22N2O6/c1-4-17(20(26)23-15-10-6-8-12-18(15)29-3)30-22(28)13(2)24-16-11-7-5-9-14(16)19(25)21(24)27/h5-13,17H,4H2,1-3H3,(H,23,26)/t13-,17+/m0/s1 |
| InChIKey | HLJSCJPVQMXWTD-SUMWQHHRSA-N |
| XLogP | 2.57 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|