C26H27F3N6O2 — CID 70274319
(3S)-3-[4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]triazol-1-yl]-3-methyl-1-(2,2,2-trifluoroethyl)-4,5,8,9-tetrahydro-1-benzazepin-2-one (PubChem CID 70274319) has the molecular formula C26H27F3N6O2 and a molecular weight of 512.54 g/mol. Its IUPAC name is (3S)-3-[4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]triazol-1-yl]-3-methyl-1-(2,2,2-trifluoroethyl)-4,5,8,9-tetrahydro-1-benzazepin-2-one.
| Compound Name | (3S)-3-[4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]triazol-1-yl]-3-methyl-1-(2,2,2-trifluoroethyl)-4,5,8,9-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 70274319 |
| Molecular Formula | C26H27F3N6O2 |
| Molecular Weight | 512.54 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | (3S)-3-[4-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]triazol-1-yl]-3-methyl-1-(2,2,2-trifluoroethyl)-4,5,8,9-tetrahydro-1-benzazepin-2-one |
| SMILES | COc1cc(-c2cn([C@@]3(C)CCC4=C(CCC=C4)N(CC(F)(F)F)C3=O)nn2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H27F3N6O2/c1-17-13-33(16-30-17)22-9-8-19(12-23(22)37-3)20-14-35(32-31-20)25(2)11-10-18-6-4-5-7-21(18)34(24(25)36)15-26(27,28)29/h4,6,8-9,12-14,16H,5,7,10-11,15H2,1-3H3/t25-/m0/s1 |
| InChIKey | RNESHCYGESXULP-VWLOTQADSA-N |
| XLogP | 4.95 |
| TPSA | 78.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |