C26H21ClF6N6O2 — CID 59472606
(3S)-7-chloro-3-[4-[4-(4-methylimidazol-1-yl)-3-(2,2,2-trifluoroethoxy)phenyl]triazol-1-yl]-1-(2,2,2-trifluoroethyl)-4,5-dihydro-3H-1-benzazepin-2-one (PubChem CID 59472606) has the molecular formula C26H21ClF6N6O2 and a molecular weight of 598.94 g/mol. Its IUPAC name is (3S)-7-chloro-3-[4-[4-(4-methylimidazol-1-yl)-3-(2,2,2-trifluoroethoxy)phenyl]triazol-1-yl]-1-(2,2,2-trifluoroethyl)-4,5-dihydro-3H-1-benzazepin-2-one.
| Compound Name | (3S)-7-chloro-3-[4-[4-(4-methylimidazol-1-yl)-3-(2,2,2-trifluoroethoxy)phenyl]triazol-1-yl]-1-(2,2,2-trifluoroethyl)-4,5-dihydro-3H-1-benzazepin-2-one |
|---|---|
| PubChem CID | 59472606 |
| Molecular Formula | C26H21ClF6N6O2 |
| Molecular Weight | 598.94 g/mol |
| Exact Mass | 598.13 |
| IUPAC Name | (3S)-7-chloro-3-[4-[4-(4-methylimidazol-1-yl)-3-(2,2,2-trifluoroethoxy)phenyl]triazol-1-yl]-1-(2,2,2-trifluoroethyl)-4,5-dihydro-3H-1-benzazepin-2-one |
| SMILES | Cc1cn(-c2ccc(-c3cn([C@H]4CCc5cc(Cl)ccc5N(CC(F)(F)F)C4=O)nn3)cc2OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C26H21ClF6N6O2/c1-15-10-37(14-34-15)21-5-2-16(9-23(21)41-13-26(31,32)33)19-11-39(36-35-19)22-6-3-17-8-18(27)4-7-20(17)38(24(22)40)12-25(28,29)30/h2,4-5,7-11,14,22H,3,6,12-13H2,1H3/t22-/m0/s1 |
| InChIKey | JBVJRJXQPGFBOJ-QFIPXVFZSA-N |
| XLogP | 6.12 |
| TPSA | 78.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.94 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |