C40H46N2 — CID 70274530
4-[1-[4-[1-[4-[1-(4-aminophenyl)prop-2-enyl]phenyl]-4-butylcyclohexyl]phenyl]prop-2-enyl]aniline (PubChem CID 70274530) has the molecular formula C40H46N2 and a molecular weight of 554.82 g/mol. Its IUPAC name is 4-[1-[4-[1-[4-[1-(4-aminophenyl)prop-2-enyl]phenyl]-4-butylcyclohexyl]phenyl]prop-2-enyl]aniline.
| Compound Name | 4-[1-[4-[1-[4-[1-(4-aminophenyl)prop-2-enyl]phenyl]-4-butylcyclohexyl]phenyl]prop-2-enyl]aniline |
|---|---|
| PubChem CID | 70274530 |
| Molecular Formula | C40H46N2 |
| Molecular Weight | 554.82 g/mol |
| Exact Mass | 554.37 |
| IUPAC Name | 4-[1-[4-[1-[4-[1-(4-aminophenyl)prop-2-enyl]phenyl]-4-butylcyclohexyl]phenyl]prop-2-enyl]aniline |
| SMILES | C=CC(c1ccc(N)cc1)c1ccc(C2(c3ccc(C(C=C)c4ccc(N)cc4)cc3)CCC(CCCC)CC2)cc1 |
| InChI | InChI=1S/C40H46N2/c1-4-7-8-29-25-27-40(28-26-29,34-17-9-30(10-18-34)38(5-2)32-13-21-36(41)22-14-32)35-19-11-31(12-20-35)39(6-3)33-15-23-37(42)24-16-33/h5-6,9-24,29,38-39H,2-4,7-8,25-28,41-42H2,1H3 |
| InChIKey | YOMIZUUBYFZWPZ-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.82 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|