C27H40N2 — CID 172731199
4-[1-(4-aminophenyl)-4-(2-propylhexyl)cyclohexyl]aniline (PubChem CID 172731199) has the molecular formula C27H40N2 and a molecular weight of 392.63 g/mol. Its IUPAC name is 4-[1-(4-aminophenyl)-4-(2-propylhexyl)cyclohexyl]aniline.
| Compound Name | 4-[1-(4-aminophenyl)-4-(2-propylhexyl)cyclohexyl]aniline |
|---|---|
| PubChem CID | 172731199 |
| Molecular Formula | C27H40N2 |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 392.32 |
| IUPAC Name | 4-[1-(4-aminophenyl)-4-(2-propylhexyl)cyclohexyl]aniline |
| SMILES | CCCCC(CCC)CC1CCC(c2ccc(N)cc2)(c2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C27H40N2/c1-3-5-7-21(6-4-2)20-22-16-18-27(19-17-22,23-8-12-25(28)13-9-23)24-10-14-26(29)15-11-24/h8-15,21-22H,3-7,16-20,28-29H2,1-2H3 |
| InChIKey | HUVNAEWTACOSKQ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|