C14H16O5-2 — CID 7027575
(2S)-2-methyl-2-(4-propoxyphenyl)butanedioate (PubChem CID 7027575) has the molecular formula C14H16O5-2 and a molecular weight of 264.28 g/mol. Its IUPAC name is (2S)-2-methyl-2-(4-propoxyphenyl)butanedioate.
| Compound Name | (2S)-2-methyl-2-(4-propoxyphenyl)butanedioate |
|---|---|
| PubChem CID | 7027575 |
| Molecular Formula | C14H16O5-2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (2S)-2-methyl-2-(4-propoxyphenyl)butanedioate |
| SMILES | CCCOc1ccc([C@](C)(CC(=O)[O-])C(=O)[O-])cc1 |
| InChI | InChI=1S/C14H18O5/c1-3-8-19-11-6-4-10(5-7-11)14(2,13(17)18)9-12(15)16/h4-7H,3,8-9H2,1-2H3,(H,15,16)(H,17,18)/p-2/t14-/m0/s1 |
| InChIKey | BFONTILBNIWFDK-AWEZNQCLSA-L |
| XLogP | -0.38 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |