C16H25NO4 — CID 174717157
tert-butyl N-[1-hydroxy-1-(4-propoxyphenyl)ethyl]carbamate (PubChem CID 174717157) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is tert-butyl N-[1-hydroxy-1-(4-propoxyphenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-hydroxy-1-(4-propoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 174717157 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | tert-butyl N-[1-hydroxy-1-(4-propoxyphenyl)ethyl]carbamate |
| SMILES | CCCOc1ccc(C(C)(O)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H25NO4/c1-6-11-20-13-9-7-12(8-10-13)16(5,19)17-14(18)21-15(2,3)4/h7-10,19H,6,11H2,1-5H3,(H,17,18) |
| InChIKey | WMZVNXNERXIWQD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|