C17H22N4OS — CID 70276223
N,N-diethyl-3-(1,2,3,4-tetrahydronaphthalen-1-ylsulfanyl)-1,2,4-triazole-1-carboxamide (PubChem CID 70276223) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is N,N-diethyl-3-(1,2,3,4-tetrahydronaphthalen-1-ylsulfanyl)-1,2,4-triazole-1-carboxamide.
| Compound Name | N,N-diethyl-3-(1,2,3,4-tetrahydronaphthalen-1-ylsulfanyl)-1,2,4-triazole-1-carboxamide |
|---|---|
| PubChem CID | 70276223 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N,N-diethyl-3-(1,2,3,4-tetrahydronaphthalen-1-ylsulfanyl)-1,2,4-triazole-1-carboxamide |
| SMILES | CCN(CC)C(=O)n1cnc(SC2CCCc3ccccc32)n1 |
| InChI | InChI=1S/C17H22N4OS/c1-3-20(4-2)17(22)21-12-18-16(19-21)23-15-11-7-9-13-8-5-6-10-14(13)15/h5-6,8,10,12,15H,3-4,7,9,11H2,1-2H3 |
| InChIKey | PLROSLOEPMVTTL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |