C12H9Cl2N2O4- — CID 7027698
(E,4Z)-2,3-dichloro-4-[(3-methoxybenzoyl)hydrazinylidene]but-2-enoate (PubChem CID 7027698) has the molecular formula C12H9Cl2N2O4- and a molecular weight of 316.12 g/mol. Its IUPAC name is (E,4Z)-2,3-dichloro-4-[(3-methoxybenzoyl)hydrazinylidene]but-2-enoate.
| Compound Name | (E,4Z)-2,3-dichloro-4-[(3-methoxybenzoyl)hydrazinylidene]but-2-enoate |
|---|---|
| PubChem CID | 7027698 |
| Molecular Formula | C12H9Cl2N2O4- |
| Molecular Weight | 316.12 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | (E,4Z)-2,3-dichloro-4-[(3-methoxybenzoyl)hydrazinylidene]but-2-enoate |
| SMILES | COc1cccc(C(=O)N/N=C\C(Cl)=C(/Cl)C(=O)[O-])c1 |
| InChI | InChI=1S/C12H10Cl2N2O4/c1-20-8-4-2-3-7(5-8)11(17)16-15-6-9(13)10(14)12(18)19/h2-6H,1H3,(H,16,17)(H,18,19)/p-1/b10-9+,15-6- |
| InChIKey | SQIAHZVUBGOWPU-DDRZNRDPSA-M |
| XLogP | 0.85 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.12 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|