C28H28N4O3 — CID 70278155
(2S)-2-[6-amino-2-oxo-3-[(1,4,6-trimethylindol-3-yl)methyl]benzimidazol-1-yl]-3-phenylpropanoic acid (PubChem CID 70278155) has the molecular formula C28H28N4O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is (2S)-2-[6-amino-2-oxo-3-[(1,4,6-trimethylindol-3-yl)methyl]benzimidazol-1-yl]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[6-amino-2-oxo-3-[(1,4,6-trimethylindol-3-yl)methyl]benzimidazol-1-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 70278155 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | (2S)-2-[6-amino-2-oxo-3-[(1,4,6-trimethylindol-3-yl)methyl]benzimidazol-1-yl]-3-phenylpropanoic acid |
| SMILES | Cc1cc(C)c2c(Cn3c(=O)n([C@@H](Cc4ccccc4)C(=O)O)c4cc(N)ccc43)cn(C)c2c1 |
| InChI | InChI=1S/C28H28N4O3/c1-17-11-18(2)26-20(15-30(3)24(26)12-17)16-31-22-10-9-21(29)14-23(22)32(28(31)35)25(27(33)34)13-19-7-5-4-6-8-19/h4-12,14-15,25H,13,16,29H2,1-3H3,(H,33,34)/t25-/m0/s1 |
| InChIKey | BGDDFNDNVUVXDN-VWLOTQADSA-N |
| XLogP | 4.41 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|