C20H23NO4S — CID 70278660
3-[5-tert-butyl-2-[(4-methylphenyl)sulfonylamino]phenyl]prop-2-enoic acid (PubChem CID 70278660) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is 3-[5-tert-butyl-2-[(4-methylphenyl)sulfonylamino]phenyl]prop-2-enoic acid.
| Compound Name | 3-[5-tert-butyl-2-[(4-methylphenyl)sulfonylamino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 70278660 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 3-[5-tert-butyl-2-[(4-methylphenyl)sulfonylamino]phenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(C)(C)C)cc2C=CC(=O)O)cc1 |
| InChI | InChI=1S/C20H23NO4S/c1-14-5-9-17(10-6-14)26(24,25)21-18-11-8-16(20(2,3)4)13-15(18)7-12-19(22)23/h5-13,21H,1-4H3,(H,22,23) |
| InChIKey | VWIYAKXAEHDLLV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|