C19H22ClFN3O+ — CID 7027960
N-(3-chlorophenyl)-3-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propanamide (PubChem CID 7027960) has the molecular formula C19H22ClFN3O+ and a molecular weight of 362.86 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propanamide.
| Compound Name | N-(3-chlorophenyl)-3-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 7027960 |
| Molecular Formula | C19H22ClFN3O+ |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-(3-chlorophenyl)-3-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propanamide |
| SMILES | O=C(CC[NH+]1CCN(c2ccccc2F)CC1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H21ClFN3O/c20-15-4-3-5-16(14-15)22-19(25)8-9-23-10-12-24(13-11-23)18-7-2-1-6-17(18)21/h1-7,14H,8-13H2,(H,22,25)/p+1 |
| InChIKey | FUIYVVXHDGGTDY-UHFFFAOYSA-O |
| XLogP | 2.21 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |