About methyl (2S)-2-[[4-(imidazo[4,5-c]pyridin-1-ylmethyl)phenyl]sulfonylamino]-3-phenylpropanoate
methyl (2S)-2-[[4-(imidazo[4,5-c]pyridin-1-ylmethyl)phenyl]sulfonylamino]-3-phenylpropanoate (PubChem CID 70283537) has the molecular formula C23H22N4O4S
and a molecular weight of 450.52 g/mol. Its IUPAC name is methyl (2S)-2-[[4-(imidazo[4,5-c]pyridin-1-ylmethyl)phenyl]sulfonylamino]-3-phenylpropanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[[4-(imidazo[4,5-c]pyridin-1-ylmethyl)phenyl]sulfonylamino]-3-phenylpropanoate |
| PubChem CID | 70283537 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | methyl (2S)-2-[[4-(imidazo[4,5-c]pyridin-1-ylmethyl)phenyl]sulfonylamino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NS(=O)(=O)c1ccc(Cn2cnc3cnccc32)cc1 |
| InChI | InChI=1S/C23H22N4O4S/c1-31-23(28)20(13-17-5-3-2-4-6-17)26-32(29,30)19-9-7-18(8-10-19)15-27-16-25-21-14-24-12-11-22(21)27/h2-12,14,16,20,26H,13,15H2,1H3/t20-/m0/s1 |
| InChIKey | HHTYDKFAQUAXND-FQEVSTJZSA-N |
| XLogP | 2.54 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl (2S)-2-[[4-(imidazo[4,5-c]pyridin-1-ylmethyl)phenyl]sulfonylamino]-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[[4-(imidazo[4,5-c]pyridin-1-ylmethyl)phenyl]sulfonylamino]-3-phenylpropanoate?
The IUPAC name of methyl (2S)-2-[[4-(imidazo[4,5-c]pyridin-1-ylmethyl)phenyl]sulfonylamino]-3-phenylpropanoate (CID 70283537) is methyl (2S)-2-[[4-(imidazo[4,5-c]pyridin-1-ylmethyl)phenyl]sulfonylamino]-3-phenylpropanoate.
What is the SMILES notation for methyl (2S)-2-[[4-(imidazo[4,5-c]pyridin-1-ylmethyl)phenyl]sulfonylamino]-3-phenylpropanoate?
The canonical SMILES for methyl (2S)-2-[[4-(imidazo[4,5-c]pyridin-1-ylmethyl)phenyl]sulfonylamino]-3-phenylpropanoate is COC(=O)[C@H](Cc1ccccc1)NS(=O)(=O)c1ccc(Cn2cnc3cnccc32)cc1.
What is the InChIKey of methyl (2S)-2-[[4-(imidazo[4,5-c]pyridin-1-ylmethyl)phenyl]sulfonylamino]-3-phenylpropanoate?
The InChIKey is HHTYDKFAQUAXND-FQEVSTJZSA-N. The full InChI is InChI=1S/C23H22N4O4S/c1-31-23(28)20(13-17-5-3-2-4-6-17)26-32(29,30)19-9-7-18(8-10-19)15-27-16-25-21-14-24-12-11-22(21)27/h2-12,14,16,20,26H,13,15H2,1H3/t20-/m0/s1.
What are the key properties of methyl (2S)-2-[[4-(imidazo[4,5-c]pyridin-1-ylmethyl)phenyl]sulfonylamino]-3-phenylpropanoate?
methyl (2S)-2-[[4-(imidazo[4,5-c]pyridin-1-ylmethyl)phenyl]sulfonylamino]-3-phenylpropanoate has a molecular weight of 450.52 g/mol, XLogP of 2.54, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[[4-(imidazo[4,5-c]pyridin-1-ylmethyl)phenyl]sulfonylamino]-3-phenylpropanoate is sourced from PubChem (CID 70283537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).