C26H42N2O4 — CID 70287213
[(Z)-octadec-9-enyl] 2-[(3-hydroxypyridine-2-carbonyl)amino]acetate (PubChem CID 70287213) has the molecular formula C26H42N2O4 and a molecular weight of 446.63 g/mol. Its IUPAC name is [(Z)-octadec-9-enyl] 2-[(3-hydroxypyridine-2-carbonyl)amino]acetate.
| Compound Name | [(Z)-octadec-9-enyl] 2-[(3-hydroxypyridine-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 70287213 |
| Molecular Formula | C26H42N2O4 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.31 |
| IUPAC Name | [(Z)-octadec-9-enyl] 2-[(3-hydroxypyridine-2-carbonyl)amino]acetate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC(=O)CNC(=O)c1ncccc1O |
| InChI | InChI=1S/C26H42N2O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-32-24(30)22-28-26(31)25-23(29)19-18-20-27-25/h9-10,18-20,29H,2-8,11-17,21-22H2,1H3,(H,28,31)/b10-9- |
| InChIKey | LNXYXBCUZDLYTO-KTKRTIGZSA-N |
| XLogP | 6.10 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|