C52H55FN2O2 — CID 70287384
N,N'-bis[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-1-fluoro-N,N'-dimethylethane-1,2-diamine (PubChem CID 70287384) has the molecular formula C52H55FN2O2 and a molecular weight of 759.02 g/mol. Its IUPAC name is N,N'-bis[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-1-fluoro-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N,N'-bis[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-1-fluoro-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 70287384 |
| Molecular Formula | C52H55FN2O2 |
| Molecular Weight | 759.02 g/mol |
| Exact Mass | 758.42 |
| IUPAC Name | N,N'-bis[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl]-1-fluoro-N,N'-dimethylethane-1,2-diamine |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(OCCN(C)CC(F)N(C)CCOc2ccc(/C(=C(/CC)c3ccccc3)c3ccccc3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C52H55FN2O2/c1-5-48(40-19-11-7-12-20-40)51(42-23-15-9-16-24-42)44-27-31-46(32-28-44)56-37-35-54(3)39-50(53)55(4)36-38-57-47-33-29-45(30-34-47)52(43-25-17-10-18-26-43)49(6-2)41-21-13-8-14-22-41/h7-34,50H,5-6,35-39H2,1-4H3/b51-48-,52-49- |
| InChIKey | JRYNSUSQYMDCEE-YCCORCDUSA-N |
| XLogP | 12.04 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.02 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|