C15H19N3O5 — CID 70287593
methyl 2-amino-2-[(5S)-3-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-2-oxo-1,3-oxazolidin-5-yl]acetate (PubChem CID 70287593) has the molecular formula C15H19N3O5 and a molecular weight of 321.33 g/mol. Its IUPAC name is methyl 2-amino-2-[(5S)-3-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-2-oxo-1,3-oxazolidin-5-yl]acetate.
| Compound Name | methyl 2-amino-2-[(5S)-3-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-2-oxo-1,3-oxazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 70287593 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | methyl 2-amino-2-[(5S)-3-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-2-oxo-1,3-oxazolidin-5-yl]acetate |
| SMILES | COC(=O)C(N)[C@@H]1CN(c2ccc3c(c2)OCCN3C)C(=O)O1 |
| InChI | InChI=1S/C15H19N3O5/c1-17-5-6-22-11-7-9(3-4-10(11)17)18-8-12(23-15(18)20)13(16)14(19)21-2/h3-4,7,12-13H,5-6,8,16H2,1-2H3/t12-,13?/m0/s1 |
| InChIKey | FCOXJBWOVJRQKV-UEWDXFNNSA-N |
| XLogP | 0.34 |
| TPSA | 94.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|