C13H13NO5 — CID 87130204
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(oxiran-2-yl)-1,3-oxazolidin-2-one (PubChem CID 87130204) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(oxiran-2-yl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(oxiran-2-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 87130204 |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(oxiran-2-yl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(C2CO2)CN1c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H13NO5/c15-13-14(6-11(19-13)12-7-18-12)8-1-2-9-10(5-8)17-4-3-16-9/h1-2,5,11-12H,3-4,6-7H2 |
| InChIKey | DZTJVVXAKVQEBC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 60.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|