C13H12ClNO4 — CID 50879370
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidine-3-carbonyl chloride (PubChem CID 50879370) has the molecular formula C13H12ClNO4 and a molecular weight of 281.70 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidine-3-carbonyl chloride.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidine-3-carbonyl chloride |
|---|---|
| PubChem CID | 50879370 |
| Molecular Formula | C13H12ClNO4 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidine-3-carbonyl chloride |
| SMILES | O=C(Cl)C1CC(=O)N(c2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C13H12ClNO4/c14-13(17)8-5-12(16)15(7-8)9-1-2-10-11(6-9)19-4-3-18-10/h1-2,6,8H,3-5,7H2 |
| InChIKey | WIMYASCYTYRXDY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|