C19H15Cl2NO5 — CID 7918211
(2,5-dichlorophenyl) (3S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 7918211) has the molecular formula C19H15Cl2NO5 and a molecular weight of 408.24 g/mol. Its IUPAC name is (2,5-dichlorophenyl) (3S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (2,5-dichlorophenyl) (3S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7918211 |
| Molecular Formula | C19H15Cl2NO5 |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | (2,5-dichlorophenyl) (3S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C(Oc1cc(Cl)ccc1Cl)[C@H]1CC(=O)N(c2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C19H15Cl2NO5/c20-12-1-3-14(21)16(8-12)27-19(24)11-7-18(23)22(10-11)13-2-4-15-17(9-13)26-6-5-25-15/h1-4,8-9,11H,5-7,10H2/t11-/m0/s1 |
| InChIKey | IGKUYBMPEHOSNI-NSHDSACASA-N |
| XLogP | 3.72 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|