C18H14FNO5 — CID 31860794
(4-fluorophenyl) (3S)-1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 31860794) has the molecular formula C18H14FNO5 and a molecular weight of 343.31 g/mol. Its IUPAC name is (4-fluorophenyl) (3S)-1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (4-fluorophenyl) (3S)-1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 31860794 |
| Molecular Formula | C18H14FNO5 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | (4-fluorophenyl) (3S)-1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C(Oc1ccc(F)cc1)[C@H]1CC(=O)N(c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C18H14FNO5/c19-12-1-4-14(5-2-12)25-18(22)11-7-17(21)20(9-11)13-3-6-15-16(8-13)24-10-23-15/h1-6,8,11H,7,9-10H2/t11-/m0/s1 |
| InChIKey | JGUWGDDSHNJPLH-NSHDSACASA-N |
| XLogP | 2.51 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|