C20H17NO7 — CID 7913319
1,3-benzodioxol-5-yl (3S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 7913319) has the molecular formula C20H17NO7 and a molecular weight of 383.36 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl (3S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | 1,3-benzodioxol-5-yl (3S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7913319 |
| Molecular Formula | C20H17NO7 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 1,3-benzodioxol-5-yl (3S)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C(Oc1ccc2c(c1)OCO2)[C@H]1CC(=O)N(c2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C20H17NO7/c22-19-7-12(20(23)28-14-2-4-16-18(9-14)27-11-26-16)10-21(19)13-1-3-15-17(8-13)25-6-5-24-15/h1-4,8-9,12H,5-7,10-11H2/t12-/m0/s1 |
| InChIKey | XUHCABZFPXADBD-LBPRGKRZSA-N |
| XLogP | 2.14 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|