C26H33Cl2FN4O3 — CID 70289145
[4-chloro-1-[5-chloro-2-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]phenyl]butyl]urea (PubChem CID 70289145) has the molecular formula C26H33Cl2FN4O3 and a molecular weight of 539.48 g/mol. Its IUPAC name is [4-chloro-1-[5-chloro-2-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]phenyl]butyl]urea.
| Compound Name | [4-chloro-1-[5-chloro-2-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]phenyl]butyl]urea |
|---|---|
| PubChem CID | 70289145 |
| Molecular Formula | C26H33Cl2FN4O3 |
| Molecular Weight | 539.48 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | [4-chloro-1-[5-chloro-2-[2-[(2R,5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-oxoethoxy]phenyl]butyl]urea |
| SMILES | C[C@@H]1CN(Cc2ccc(F)cc2)[C@@H](C)CN1C(=O)COc1ccc(Cl)cc1C(CCCCl)NC(N)=O |
| InChI | InChI=1S/C26H33Cl2FN4O3/c1-17-14-33(18(2)13-32(17)15-19-5-8-21(29)9-6-19)25(34)16-36-24-10-7-20(28)12-22(24)23(4-3-11-27)31-26(30)35/h5-10,12,17-18,23H,3-4,11,13-16H2,1-2H3,(H3,30,31,35)/t17-,18+,23?/m0/s1 |
| InChIKey | WVWKOJFEPJKKRX-BSKKSYLPSA-N |
| XLogP | 4.71 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|