C26H33N5O3 — CID 70289205
N-[[4-(4-cyclohexylbutoxy)phenyl]methyl]-3-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-amine (PubChem CID 70289205) has the molecular formula C26H33N5O3 and a molecular weight of 463.58 g/mol. Its IUPAC name is N-[[4-(4-cyclohexylbutoxy)phenyl]methyl]-3-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-amine.
| Compound Name | N-[[4-(4-cyclohexylbutoxy)phenyl]methyl]-3-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-amine |
|---|---|
| PubChem CID | 70289205 |
| Molecular Formula | C26H33N5O3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | N-[[4-(4-cyclohexylbutoxy)phenyl]methyl]-3-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-amine |
| SMILES | c1cc(NCc2ccc(OCCCCC3CCCCC3)cc2)c2c(c1)OCC(c1nn[nH]n1)O2 |
| InChI | InChI=1S/C26H33N5O3/c1-2-7-19(8-3-1)9-4-5-16-32-21-14-12-20(13-15-21)17-27-22-10-6-11-23-25(22)34-24(18-33-23)26-28-30-31-29-26/h6,10-15,19,24,27H,1-5,7-9,16-18H2,(H,28,29,30,31) |
| InChIKey | GAHBWQPSCNAEJM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|