C21H21N5O4 — CID 18795847
4-[(E)-pent-1-enoxy]-N-[3-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide (PubChem CID 18795847) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is 4-[(E)-pent-1-enoxy]-N-[3-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide.
| Compound Name | 4-[(E)-pent-1-enoxy]-N-[3-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide |
|---|---|
| PubChem CID | 18795847 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 4-[(E)-pent-1-enoxy]-N-[3-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]benzamide |
| SMILES | CCC/C=C/Oc1ccc(C(=O)Nc2cccc3c2OC(c2nn[nH]n2)CO3)cc1 |
| InChI | InChI=1S/C21H21N5O4/c1-2-3-4-12-28-15-10-8-14(9-11-15)21(27)22-16-6-5-7-17-19(16)30-18(13-29-17)20-23-25-26-24-20/h4-12,18H,2-3,13H2,1H3,(H,22,27)(H,23,24,25,26)/b12-4+ |
| InChIKey | IKLMKKJMCVEIHC-UUILKARUSA-N |
| XLogP | 3.66 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|