C24H25N5O5 — CID 54538408
[4-[[3-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]carbamoyl]phenyl] oct-2-enoate (PubChem CID 54538408) has the molecular formula C24H25N5O5 and a molecular weight of 463.49 g/mol. Its IUPAC name is [4-[[3-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]carbamoyl]phenyl] oct-2-enoate.
| Compound Name | [4-[[3-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]carbamoyl]phenyl] oct-2-enoate |
|---|---|
| PubChem CID | 54538408 |
| Molecular Formula | C24H25N5O5 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | [4-[[3-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]carbamoyl]phenyl] oct-2-enoate |
| SMILES | CCCCCC=CC(=O)Oc1ccc(C(=O)Nc2cccc3c2OC(c2nn[nH]n2)CO3)cc1 |
| InChI | InChI=1S/C24H25N5O5/c1-2-3-4-5-6-10-21(30)33-17-13-11-16(12-14-17)24(31)25-18-8-7-9-19-22(18)34-20(15-32-19)23-26-28-29-27-23/h6-14,20H,2-5,15H2,1H3,(H,25,31)(H,26,27,28,29) |
| InChIKey | ZBKBACXSALDXAL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 128.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|