C28H33N5O4 — CID 54492485
3-(4-dec-2-enoxyphenyl)-N-[3-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]prop-2-enamide (PubChem CID 54492485) has the molecular formula C28H33N5O4 and a molecular weight of 503.60 g/mol. Its IUPAC name is 3-(4-dec-2-enoxyphenyl)-N-[3-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]prop-2-enamide.
| Compound Name | 3-(4-dec-2-enoxyphenyl)-N-[3-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 54492485 |
| Molecular Formula | C28H33N5O4 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | 3-(4-dec-2-enoxyphenyl)-N-[3-(2H-tetrazol-5-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]prop-2-enamide |
| SMILES | CCCCCCCC=CCOc1ccc(C=CC(=O)Nc2cccc3c2OC(c2nn[nH]n2)CO3)cc1 |
| InChI | InChI=1S/C28H33N5O4/c1-2-3-4-5-6-7-8-9-19-35-22-16-13-21(14-17-22)15-18-26(34)29-23-11-10-12-24-27(23)37-25(20-36-24)28-30-32-33-31-28/h8-18,25H,2-7,19-20H2,1H3,(H,29,34)(H,30,31,32,33) |
| InChIKey | XWSFPJFXWZKJHO-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|