C14H15N2O4- — CID 7029002
(E)-4-oxo-4-[2-(4-propan-2-ylbenzoyl)hydrazinyl]but-2-enoate (PubChem CID 7029002) has the molecular formula C14H15N2O4- and a molecular weight of 275.28 g/mol. Its IUPAC name is (E)-4-oxo-4-[2-(4-propan-2-ylbenzoyl)hydrazinyl]but-2-enoate.
| Compound Name | (E)-4-oxo-4-[2-(4-propan-2-ylbenzoyl)hydrazinyl]but-2-enoate |
|---|---|
| PubChem CID | 7029002 |
| Molecular Formula | C14H15N2O4- |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | (E)-4-oxo-4-[2-(4-propan-2-ylbenzoyl)hydrazinyl]but-2-enoate |
| SMILES | CC(C)c1ccc(C(=O)NNC(=O)/C=C/C(=O)[O-])cc1 |
| InChI | InChI=1S/C14H16N2O4/c1-9(2)10-3-5-11(6-4-10)14(20)16-15-12(17)7-8-13(18)19/h3-9H,1-2H3,(H,15,17)(H,16,20)(H,18,19)/p-1/b8-7+ |
| InChIKey | UCFOUJFJIJIMMA-BQYQJAHWSA-M |
| XLogP | -0.12 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|