C22H31NO3 — CID 70290744
tert-butyl (5R,13S)-13-phenyl-1-oxa-12-azaspiro[4.8]tridec-3-ene-12-carboxylate (PubChem CID 70290744) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is tert-butyl (5R,13S)-13-phenyl-1-oxa-12-azaspiro[4.8]tridec-3-ene-12-carboxylate.
| Compound Name | tert-butyl (5R,13S)-13-phenyl-1-oxa-12-azaspiro[4.8]tridec-3-ene-12-carboxylate |
|---|---|
| PubChem CID | 70290744 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | tert-butyl (5R,13S)-13-phenyl-1-oxa-12-azaspiro[4.8]tridec-3-ene-12-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCCC[C@@]2(C=CCO2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H31NO3/c1-21(2,3)26-20(24)23-16-10-5-4-9-14-22(15-11-17-25-22)19(23)18-12-7-6-8-13-18/h6-8,11-13,15,19H,4-5,9-10,14,16-17H2,1-3H3/t19-,22+/m0/s1 |
| InChIKey | UIXQXAJXFWPSGC-SIKLNZKXSA-N |
| XLogP | 5.25 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|