C10H17BN2O2 — CID 70292940
1-ethyl-5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 70292940) has the molecular formula C10H17BN2O2 and a molecular weight of 208.07 g/mol. Its IUPAC name is 1-ethyl-5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 1-ethyl-5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 70292940 |
| Molecular Formula | C10H17BN2O2 |
| Molecular Weight | 208.07 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 1-ethyl-5-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | CCn1nccc1B1OC(C)C(C)(C)O1 |
| InChI | InChI=1S/C10H17BN2O2/c1-5-13-9(6-7-12-13)11-14-8(2)10(3,4)15-11/h6-8H,5H2,1-4H3 |
| InChIKey | AWNHCNDZIJGWEY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.07 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|