C20H18N4OS — CID 7029771
(4S,5R)-2-(2,3-dihydroindol-1-yl)-6-imino-4-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazine-5-carbonitrile (PubChem CID 7029771) has the molecular formula C20H18N4OS and a molecular weight of 362.46 g/mol. Its IUPAC name is (4S,5R)-2-(2,3-dihydroindol-1-yl)-6-imino-4-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazine-5-carbonitrile.
| Compound Name | (4S,5R)-2-(2,3-dihydroindol-1-yl)-6-imino-4-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazine-5-carbonitrile |
|---|---|
| PubChem CID | 7029771 |
| Molecular Formula | C20H18N4OS |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | (4S,5R)-2-(2,3-dihydroindol-1-yl)-6-imino-4-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazine-5-carbonitrile |
| SMILES | [H]/N=C1\SC(N2CCc3ccccc32)=N[C@H](c2ccc(OC)cc2)[C@@H]1C#N |
| InChI | InChI=1S/C20H18N4OS/c1-25-15-8-6-14(7-9-15)18-16(12-21)19(22)26-20(23-18)24-11-10-13-4-2-3-5-17(13)24/h2-9,16,18,22H,10-11H2,1H3/b22-19-/t16-,18+/m0/s1 |
| InChIKey | GHFNDYMZQSQIOY-NLYMGMPHSA-N |
| XLogP | 4.02 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|