About 3-(1,4-diazepan-1-yl)-8-methyl-8-azabicyclo[3.2.1]octane;trihydrochloride
3-(1,4-diazepan-1-yl)-8-methyl-8-azabicyclo[3.2.1]octane;trihydrochloride (PubChem CID 70298410) has the molecular formula C13H28Cl3N3
and a molecular weight of 332.75 g/mol. Its IUPAC name is 3-(1,4-diazepan-1-yl)-8-methyl-8-azabicyclo[3.2.1]octane;trihydrochloride.
Molecular Properties
| Compound Name | 3-(1,4-diazepan-1-yl)-8-methyl-8-azabicyclo[3.2.1]octane;trihydrochloride |
| PubChem CID | 70298410 |
| Molecular Formula | C13H28Cl3N3 |
| Molecular Weight | 332.75 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 3-(1,4-diazepan-1-yl)-8-methyl-8-azabicyclo[3.2.1]octane;trihydrochloride |
| SMILES | CN1C2CCC1CC(N1CCCNCC1)C2.Cl.Cl.Cl |
| InChI | InChI=1S/C13H25N3.3ClH/c1-15-11-3-4-12(15)10-13(9-11)16-7-2-5-14-6-8-16;;;/h11-14H,2-10H2,1H3;3*1H |
| InChIKey | YRZONJKGMSXLKX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.75 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1,4-diazepan-1-yl)-8-methyl-8-azabicyclo[3.2.1]octane;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,4-diazepan-1-yl)-8-methyl-8-azabicyclo[3.2.1]octane;trihydrochloride?
The IUPAC name of 3-(1,4-diazepan-1-yl)-8-methyl-8-azabicyclo[3.2.1]octane;trihydrochloride (CID 70298410) is 3-(1,4-diazepan-1-yl)-8-methyl-8-azabicyclo[3.2.1]octane;trihydrochloride.
What is the SMILES notation for 3-(1,4-diazepan-1-yl)-8-methyl-8-azabicyclo[3.2.1]octane;trihydrochloride?
The canonical SMILES for 3-(1,4-diazepan-1-yl)-8-methyl-8-azabicyclo[3.2.1]octane;trihydrochloride is CN1C2CCC1CC(N1CCCNCC1)C2.Cl.Cl.Cl.
What is the InChIKey of 3-(1,4-diazepan-1-yl)-8-methyl-8-azabicyclo[3.2.1]octane;trihydrochloride?
The InChIKey is YRZONJKGMSXLKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3.3ClH/c1-15-11-3-4-12(15)10-13(9-11)16-7-2-5-14-6-8-16;;;/h11-14H,2-10H2,1H3;3*1H.
What are the key properties of 3-(1,4-diazepan-1-yl)-8-methyl-8-azabicyclo[3.2.1]octane;trihydrochloride?
3-(1,4-diazepan-1-yl)-8-methyl-8-azabicyclo[3.2.1]octane;trihydrochloride has a molecular weight of 332.75 g/mol, XLogP of 2.17, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,4-diazepan-1-yl)-8-methyl-8-azabicyclo[3.2.1]octane;trihydrochloride is sourced from PubChem (CID 70298410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).