C25H27NO9 — CID 70298417
3-(2-nitro-5-phenylmethoxyphenyl)-2-oxopropanoic acid;(Z)-2-oxonon-5-enoic acid (PubChem CID 70298417) has the molecular formula C25H27NO9 and a molecular weight of 485.49 g/mol. Its IUPAC name is 3-(2-nitro-5-phenylmethoxyphenyl)-2-oxopropanoic acid;(Z)-2-oxonon-5-enoic acid.
| Compound Name | 3-(2-nitro-5-phenylmethoxyphenyl)-2-oxopropanoic acid;(Z)-2-oxonon-5-enoic acid |
|---|---|
| PubChem CID | 70298417 |
| Molecular Formula | C25H27NO9 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 3-(2-nitro-5-phenylmethoxyphenyl)-2-oxopropanoic acid;(Z)-2-oxonon-5-enoic acid |
| SMILES | CCC/C=C\CCC(=O)C(=O)O.O=C(O)C(=O)Cc1cc(OCc2ccccc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13NO6.C9H14O3/c18-15(16(19)20)9-12-8-13(6-7-14(12)17(21)22)23-10-11-4-2-1-3-5-11;1-2-3-4-5-6-7-8(10)9(11)12/h1-8H,9-10H2,(H,19,20);4-5H,2-3,6-7H2,1H3,(H,11,12)/b;5-4- |
| InChIKey | DHLSLRQFOCAFSE-GUHKXDMSSA-N |
| XLogP | 4.15 |
| TPSA | 161.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|