C21H27N5O2 — CID 70300541
6-(4-morpholin-4-ylanilino)-N-piperidin-4-ylpyridine-2-carboxamide (PubChem CID 70300541) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 6-(4-morpholin-4-ylanilino)-N-piperidin-4-ylpyridine-2-carboxamide.
| Compound Name | 6-(4-morpholin-4-ylanilino)-N-piperidin-4-ylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 70300541 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 6-(4-morpholin-4-ylanilino)-N-piperidin-4-ylpyridine-2-carboxamide |
| SMILES | O=C(NC1CCNCC1)c1cccc(Nc2ccc(N3CCOCC3)cc2)n1 |
| InChI | InChI=1S/C21H27N5O2/c27-21(24-17-8-10-22-11-9-17)19-2-1-3-20(25-19)23-16-4-6-18(7-5-16)26-12-14-28-15-13-26/h1-7,17,22H,8-15H2,(H,23,25)(H,24,27) |
| InChIKey | UAJFYYZUDCHALB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|