C25H25F3N2O5 — CID 70301152
(4R,4aR,7S,7aR,12bS)-3-methyl-7-[[3-(trifluoromethyl)-2-pyridinyl]oxy]-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol;acetic acid (PubChem CID 70301152) has the molecular formula C25H25F3N2O5 and a molecular weight of 490.48 g/mol. Its IUPAC name is (4R,4aR,7S,7aR,12bS)-3-methyl-7-[[3-(trifluoromethyl)-2-pyridinyl]oxy]-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol;acetic acid.
| Compound Name | (4R,4aR,7S,7aR,12bS)-3-methyl-7-[[3-(trifluoromethyl)-2-pyridinyl]oxy]-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol;acetic acid |
|---|---|
| PubChem CID | 70301152 |
| Molecular Formula | C25H25F3N2O5 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | (4R,4aR,7S,7aR,12bS)-3-methyl-7-[[3-(trifluoromethyl)-2-pyridinyl]oxy]-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol;acetic acid |
| SMILES | CC(=O)O.CN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@H](Oc2ncccc2C(F)(F)F)C=C[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C23H21F3N2O3.C2H4O2/c1-28-10-8-22-13-5-7-17(30-21-14(23(24,25)26)3-2-9-27-21)20(22)31-19-16(29)6-4-12(18(19)22)11-15(13)28;1-2(3)4/h2-7,9,13,15,17,20,29H,8,10-11H2,1H3;1H3,(H,3,4)/t13-,15+,17-,20-,22-;/m0./s1 |
| InChIKey | SZXZCRMHQCGUHX-HTYNIZDGSA-N |
| XLogP | 3.79 |
| TPSA | 92.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|