C26H27NO5 — CID 70303357
3-benzhydryl-5,5-dimethoxy-4-[methoxy(phenyl)methyl]-1,3-oxazolidin-2-one (PubChem CID 70303357) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is 3-benzhydryl-5,5-dimethoxy-4-[methoxy(phenyl)methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-benzhydryl-5,5-dimethoxy-4-[methoxy(phenyl)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 70303357 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 3-benzhydryl-5,5-dimethoxy-4-[methoxy(phenyl)methyl]-1,3-oxazolidin-2-one |
| SMILES | COC(c1ccccc1)C1N(C(c2ccccc2)c2ccccc2)C(=O)OC1(OC)OC |
| InChI | InChI=1S/C26H27NO5/c1-29-23(21-17-11-6-12-18-21)24-26(30-2,31-3)32-25(28)27(24)22(19-13-7-4-8-14-19)20-15-9-5-10-16-20/h4-18,22-24H,1-3H3 |
| InChIKey | VESVBDGEKVEGHG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|