C16H20O6 — CID 102014082
methyl (3S,4R,5R)-5-methoxy-4-[methoxy(phenyl)methyl]-5-methyl-2-oxooxolane-3-carboxylate (PubChem CID 102014082) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is methyl (3S,4R,5R)-5-methoxy-4-[methoxy(phenyl)methyl]-5-methyl-2-oxooxolane-3-carboxylate.
| Compound Name | methyl (3S,4R,5R)-5-methoxy-4-[methoxy(phenyl)methyl]-5-methyl-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 102014082 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | methyl (3S,4R,5R)-5-methoxy-4-[methoxy(phenyl)methyl]-5-methyl-2-oxooxolane-3-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)O[C@@](C)(OC)[C@H]1C(OC)c1ccccc1 |
| InChI | InChI=1S/C16H20O6/c1-16(21-4)12(11(14(17)20-3)15(18)22-16)13(19-2)10-8-6-5-7-9-10/h5-9,11-13H,1-4H3/t11-,12+,13?,16+/m0/s1 |
| InChIKey | UKEVTCWDPYLNEI-SZJPGTGFSA-N |
| XLogP | 1.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|