C12H20O6 — CID 15818515
methyl (3R,4S)-4-(2,2-dimethoxyethyl)-5,5-dimethyl-2-oxooxolane-3-carboxylate (PubChem CID 15818515) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is methyl (3R,4S)-4-(2,2-dimethoxyethyl)-5,5-dimethyl-2-oxooxolane-3-carboxylate.
| Compound Name | methyl (3R,4S)-4-(2,2-dimethoxyethyl)-5,5-dimethyl-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 15818515 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | methyl (3R,4S)-4-(2,2-dimethoxyethyl)-5,5-dimethyl-2-oxooxolane-3-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)OC(C)(C)[C@H]1CC(OC)OC |
| InChI | InChI=1S/C12H20O6/c1-12(2)7(6-8(15-3)16-4)9(10(13)17-5)11(14)18-12/h7-9H,6H2,1-5H3/t7-,9+/m0/s1 |
| InChIKey | GTYZRAOGQILKOP-IONNQARKSA-N |
| XLogP | 0.74 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|